ChemIndex - A free chemical CAS databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
152323-73-4 N-{(2S,3Z)-2-({[(3R,6R,8aS)-6-amino-5-oxohexahydro-5H-[1,3]thiazolo[3,2-a]pyridin-3-yl]carbonyl}amino)-5-[(diaminomethylidene)amino]pent-3-enoyl}glycyl-N-[(1S)-1-benzyl-2-oxoethyl]-L-alpha-asparagine |
|
| Chemical Name | N-{(2S,3Z)-2-({[(3R,6R,8aS)-6-amino-5-oxohexahydro-5H-[1,3]thiazolo[3,2-a]pyridin-3-yl]carbonyl}amino)-5-[(diaminomethylidene)amino]pent-3-enoyl}glycyl-N-[(1S)-1-benzyl-2-oxoethyl]-L-alpha-asparagine |
| Molecular Formula | C29H39N9O8S |
| Molecular Weight | 673.7405 |
| InChl | InChI=1/C29H39N9O8S/c30-18-8-9-23-38(28(18)46)21(15-47-23)27(45)37-19(7-4-10-33-29(31)32)25(43)34-13-22(40)36-20(12-24(41)42)26(44)35-17(14-39)11-16-5-2-1-3-6-16/h1-7,14,17-21,23H,8-13,15,30H2,(H,34,43)(H,35,44)(H,36,40)(H,37,45)(H,41,42)(H4,31,32,33)/b7-4-/t17-,18+,19-,20-,21-,23-/m0/s1 |
| CAS Registry Number | 152323-73-4 |
| Molecular Structure | ![]() |
| Density | 1.56g/cm3 |
| Refractive Index | 1.71 |
| MSDS | |