15329-69-8 N-Benzylmaleamic acid |
|
| Product Name | N-Benzylmaleamic acid |
| Synonyms | Maleic acid monobenzylamide;4-(benzylamino)-4-oxobut-2-enoic acid;(2Z)-4-(benzylamino)-4-oxobut-2-enoic acid;(2E)-4-(benzylamino)-4-oxobut-2-enoate |
| Molecular Formula | C11H10NO3 |
| Molecular Weight | 204.2025 |
| InChl | InChI=1/C11H11NO3/c13-10(6-7-11(14)15)12-8-9-4-2-1-3-5-9/h1-7H,8H2,(H,12,13)(H,14,15)/p-1/b7-6+ |
| CAS Registry Number | 15329-69-8 |
| EINECS | 239-361-6 |
| Molecular Structure |  |
| Melting Point | 136-138℃ |
| Boiling Point | 476.3°C at 760 mmHg |
| Flash Point | 241.9°C |
| Vapour Pressur | 7.01E-10mmHg at 25°C |
| Risk Codes | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
| Safety Description | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36##Wear suitable protective clothing.:; |
- Alfa Aesar
TEL:1-800-343-7276
FAX:1-978-521-6366
