ChemIndex - A free chemical CAS databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
16783-22-5 octahydro-1H-inden-1-one |
|
| Chemical Name | octahydro-1H-inden-1-one |
| Synonyms | 1H-Inden-1-one, octahydro-;1-Indanone, hexahydro- |
| Molecular Formula | C9H14O |
| Molecular Weight | 138.2069 |
| InChl | InChI=1/C9H14O/c10-9-6-5-7-3-1-2-4-8(7)9/h7-8H,1-6H2 |
| CAS Registry Number | 16783-22-5;2826-65-5;29927-85-3 |
| Molecular Structure | ![]() |
| Density | 1.007g/cm3 |
| Boiling Point | 219.8°C at 760 mmHg |
| Refractive Index | 1.49 |
| Flash Point | 79.6°C |
| Vapour Pressur | 0.117mmHg at 25°C |
| MSDS | |