ChemIndex - A free chemical CAS databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
17422-32-1 5-Chloroindole |
|
| Chemical Name | 5-Chloroindole |
| Synonyms | 1H-Indole,5-chloro-(9CI); ;5-chloro-1H-indole |
| Molecular Formula | C8H6ClN |
| Molecular Weight | 151.5929 |
| InChl | InChI=1/C8H6ClN/c9-7-1-2-8-6(5-7)3-4-10-8/h1-5,10H |
| CAS Registry Number | 17422-32-1 |
| EINECS | 241-448-9 |
| Molecular Structure | ![]() |
| Density | 1.331g/cm3 |
| Melting Point | 69-71℃ |
| Boiling Point | 293°C at 760 mmHg |
| Refractive Index | 1.688 |
| Flash Point | 158.9°C |
| Vapour Pressur | 0.00309mmHg at 25°C |
| Hazard Symbols | |
| Risk Codes | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
| Safety Description | S22||S24/25:; |
| MSDS | |