18711-13-2 4,7-Dichloroisatin |
| Product Name |
4,7-Dichloroisatin |
| Synonyms |
4,7-dichloro-1H-indole-2,3-dione;4,7-Dichloroindoline-2,3-dione |
| Molecular Formula |
C8H3Cl2NO2 |
| Molecular Weight |
216.0209 |
| InChl |
InChI=1/C8H3Cl2NO2/c9-3-1-2-4(10)6-5(3)7(12)8(13)11-6/h1-2H,(H,11,12,13) |
| CAS Registry Number |
18711-13-2 |
| Molecular Structure |
 |
| Density |
1.643g/cm3 |
| Melting Point |
251-254℃ |
| Refractive Index |
1.637 |
| Hazard Symbols |
 Xi##Irritant:;
|
| Risk Codes |
R36/37/38##Irritating to eyes, respiratory system and skin.:;
|
| Safety Description |
S22##Do not inhale dust.||S24/25##Avoid contact with skin and eyes.:;
|
