ChemIndex - A free chemical CAS databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
2008-46-0 triethylammonium (2,4,5-trichlorophenoxy)acetate |
|
| Chemical Name | triethylammonium (2,4,5-trichlorophenoxy)acetate |
| Synonyms | 2,4,5-T-triethylammonium [ISO];2,4,5-T triethylamine salt;2,4,5-T-triethylammonium;2,4,5-Trichlorophenoxyacetic acid triethylamine salt;Caswell No. 881K;EPA Pesticide Chemical Code 082034;Acetic acid, (2,4,5-trichlorophenoxy)-, compd. with N,N-diethylethanamine (1:1);2,4,5-T Triethylamine;Acetic acid, (2,4,5-trichlorophenoxy)-, compd. with N,N-diethylethanamine;(2,4,5-trichlorophenoxy)acetic acid - N,N-diethylethanamine (1:1) |
| Molecular Formula | C14H20Cl3NO3 |
| Molecular Weight | 356.6725 |
| InChl | InChI=1/C8H5Cl3O3.C6H15N/c9-4-1-6(11)7(2-5(4)10)14-3-8(12)13;1-4-7(5-2)6-3/h1-2H,3H2,(H,12,13);4-6H2,1-3H3 |
| CAS Registry Number | 2008-46-0 |
| EINECS | 217-917-9 |
| Molecular Structure | ![]() |
| Boiling Point | 376.3°C at 760 mmHg |
| Flash Point | 181.4°C |
| Vapour Pressur | 2.48E-06mmHg at 25°C |
| MSDS | |