ChemIndex - A free chemical CAS databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
207226-37-7 2,6-difluorostyrene |
|
| Chemical Name | 2,6-difluorostyrene |
| Synonyms | 2-ethenyl-1,3-difluorobenzene |
| Molecular Formula | C8H6F2 |
| Molecular Weight | 140.13 |
| InChl | InChI=1/C8H6F2/c1-2-6-7(9)4-3-5-8(6)10/h2-5H,1H2 |
| CAS Registry Number | 207226-37-7 |
| Molecular Structure | ![]() |
| Density | 1.131g/cm3 |
| Boiling Point | 138.3°C at 760 mmHg |
| Refractive Index | 1.512 |
| Flash Point | 27.3°C |
| Vapour Pressur | 8.42mmHg at 25°C |
| MSDS | |