207981-50-8 2,6-difluoromandelic acid |
| Product Name |
2,6-difluoromandelic acid |
| Synonyms |
alpha-Hydroxy-2,6-difluorophenylacetic acid;(2,6-difluorophenyl)(hydroxy)acetic acid |
| Molecular Formula |
C8H6F2O3 |
| Molecular Weight |
188.1282 |
| InChl |
InChI=1/C8H6F2O3/c9-4-2-1-3-5(10)6(4)7(11)8(12)13/h1-3,7,11H,(H,12,13) |
| CAS Registry Number |
207981-50-8 |
| Molecular Structure |
 |
| Density |
1.522g/cm3 |
| Boiling Point |
299.3°C at 760 mmHg |
| Refractive Index |
1.542 |
| Flash Point |
134.8°C |
| Vapour Pressur |
0.000539mmHg at 25°C |
| Risk Codes |
R36/37/38##Irritating to eyes, respiratory system and skin.:;
|
| Safety Description |
S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36##Wear suitable protective clothing.:;
|
