ChemIndex - A free chemical CAS databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
21323-19-3 6,6'-[piperazine-1,4-diylbis(iminomethylylidene)]bis(4-bromocyclohexa-2,4-dien-1-one) |
|
| Chemical Name | 6,6'-[piperazine-1,4-diylbis(iminomethylylidene)]bis(4-bromocyclohexa-2,4-dien-1-one) |
| Molecular Formula | C18H18Br2N4O2 |
| Molecular Weight | 482.1691 |
| InChl | InChI=1/C18H18Br2N4O2/c19-15-1-3-17(25)13(9-15)11-21-23-5-7-24(8-6-23)22-12-14-10-16(20)2-4-18(14)26/h1-4,9-12,21-22H,5-8H2 |
| CAS Registry Number | 21323-19-3 |
| Molecular Structure | ![]() |
| Density | 1.74g/cm3 |
| Boiling Point | 498.3°C at 760 mmHg |
| Refractive Index | 1.715 |
| Flash Point | 255.2°C |
| Vapour Pressur | 4.59E-10mmHg at 25°C |
| MSDS | |