24199-46-0 6-Ethyl-5-hepten-2-one |
|
| Product Name | 6-Ethyl-5-hepten-2-one |
| Synonyms | 6-Methyl-5-octen-2-one;6-methyloct-5-en-2-one |
| Molecular Formula | C9H16O |
| Molecular Weight | 140.2227 |
| InChl | InChI=1/C9H16O/c1-4-8(2)6-5-7-9(3)10/h6H,4-5,7H2,1-3H3 |
| CAS Registry Number | 24199-46-0 |
| EINECS | 246-073-4 |
| Molecular Structure |  |
| Density | 0.836g/cm3 |
| Boiling Point | 195.2°C at 760 mmHg |
| Refractive Index | 1.434 |
| Flash Point | 62.2°C |
| Vapour Pressur | 0.425mmHg at 25°C |
- If you plan to source chemicals from China, just go to ChemNet mall, we will get the latest and competitive price from China manufacturers for you. Please visit
ChemNet Mall
