24910-73-4 1,3-dichloro-5-(4-chlorophenoxy)benzene |
|
| Product Name | 1,3-dichloro-5-(4-chlorophenoxy)benzene |
| Molecular Formula | C12H7Cl3O |
| Molecular Weight | 273.5424 |
| InChl | InChI=1/C12H7Cl3O/c13-8-1-3-11(4-2-8)16-12-6-9(14)5-10(15)7-12/h1-7H |
| CAS Registry Number | 24910-73-4 |
| Molecular Structure |  |
| Density | 1.396g/cm3 |
| Boiling Point | 343.8°C at 760 mmHg |
| Refractive Index | 1.604 |
| Flash Point | 129.3°C |
| Vapour Pressur | 0.000137mmHg at 25°C |
- If you plan to source chemicals from China, just go to ChemNet mall, we will get the latest and competitive price from China manufacturers for you. Please visit
ChemNet Mall
