ChemIndex - A free chemical CAS databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
249278-33-9 3-[2,3-di(benzyloxy)phenyl]propanenitrile |
|
| Chemical Name | 3-[2,3-di(benzyloxy)phenyl]propanenitrile |
| Synonyms | 3-[2,3-bis(benzyloxy)phenyl]propanenitrile |
| Molecular Formula | C23H21NO2 |
| Molecular Weight | 343.4183 |
| InChl | InChI=1/C23H21NO2/c24-16-8-14-21-13-7-15-22(25-17-19-9-3-1-4-10-19)23(21)26-18-20-11-5-2-6-12-20/h1-7,9-13,15H,8,14,17-18H2 |
| CAS Registry Number | 249278-33-9 |
| Molecular Structure | ![]() |
| Density | 1.138g/cm3 |
| Melting Point | 200℃ |
| Boiling Point | 525.9°C at 760 mmHg |
| Refractive Index | 1.596 |
| Flash Point | 174.5°C |
| Vapour Pressur | 3.75E-11mmHg at 25°C |
| Hazard Symbols | |
| Risk Codes | R20/21/22##Harmful by inhalation, in contact with skin and if swallowed.:; |
| Safety Description | S36/37##Wear suitable protective clothing and gloves.:; |
| MSDS | |