ChemIndex - A free chemical CAS databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
2929-81-9 2-[4-(dimethylamino)benzylidene]hydrazinecarbothioamide |
|
| Chemical Name | 2-[4-(dimethylamino)benzylidene]hydrazinecarbothioamide |
| Molecular Formula | C10H14N4S |
| Molecular Weight | 222.31 |
| InChl | InChI=1/C10H14N4S/c1-14(2)9-5-3-8(4-6-9)7-12-13-10(11)15/h3-7H,1-2H3,(H3,11,13,15) |
| CAS Registry Number | 2929-81-9 |
| Molecular Structure | ![]() |
| Density | 1.17g/cm3 |
| Boiling Point | 377.6°C at 760 mmHg |
| Refractive Index | 1.603 |
| Flash Point | 182.2°C |
| Vapour Pressur | 6.67E-06mmHg at 25°C |
| MSDS | |