ChemIndex - A free chemical CAS databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
303-54-8 depramine |
|
| Chemical Name | depramine |
| Synonyms | Depramine [INN];10,11-Dehydroimipramine;5-(3-(Dimethylamino)propyl)-5H-dibenz(b,f)azepine;5-20-08-00247 (Beilstein Handbook Reference);BRN 1319717;Balipramine;Depramina;Depramina [INN-Spanish];Depramine;Depraminum;Depraminum [INN-Latin];GP 31406;UNII-77C3T28736;5H-Dibenz(b,f)azepine, 5-(3-(dimethylamino)propyl)-;5H-Dibenz(b,f)azepine-5-propanamine, N,N-dimethyl- (9CI);3-(5H-dibenzo[b,f]azepin-5-yl)-N,N-dimethylpropan-1-amine |
| Molecular Formula | C19H22N2 |
| Molecular Weight | 278.3914 |
| InChl | InChI=1/C19H22N2/c1-20(2)14-7-15-21-18-10-5-3-8-16(18)12-13-17-9-4-6-11-19(17)21/h3-6,8-13H,7,14-15H2,1-2H3 |
| CAS Registry Number | 303-54-8 |
| Molecular Structure | ![]() |
| Density | 1.06g/cm3 |
| Boiling Point | 413.9°C at 760 mmHg |
| Refractive Index | 1.589 |
| Flash Point | 185.9°C |
| Vapour Pressur | 4.64E-07mmHg at 25°C |
| MSDS | |