ChemIndex - A free chemical CAS databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
304-91-6 2-iodosobenzoic acid moistened with water (H2O ~10%) |
|
| Chemical Name | 2-iodosobenzoic acid moistened with water (H2O ~10%) |
| Synonyms | o-Iodosobenzoic acid 2-Iodosobenzoic acid;Iodosobenzoicacid;2-iodosylbenzoic acid |
| Molecular Formula | C7H5IO3 |
| Molecular Weight | 264.0173 |
| InChl | InChI=1/C7H5IO3/c9-7(10)5-3-1-2-4-6(5)8-11/h1-4H,(H,9,10) |
| CAS Registry Number | 304-91-6 |
| EINECS | 206-159-4 |
| Molecular Structure | ![]() |
| Melting Point | 230℃ (dec.) |
| Hazard Symbols | |
| Risk Codes | R36/37/38:; |
| Safety Description | S26||S36:; |
| MSDS | |