3148-72-9 1,3-Diamino-2-hydroxypropane-N,N,N',N'-tetraacetic acid |
| Product Name |
1,3-Diamino-2-hydroxypropane-N,N,N',N'-tetraacetic acid |
| Synonyms |
1,3-Diamino-2-propanol-N,N,N,N-tetraacetic acid;2-hydroxytrimethylenediaminetetra(acetic acid);DiaminopropanolNNNNtetraaceticacid;2,2',2'',2'''-[(2-hydroxypropane-1,3-diyl)dinitrilo]tetraacetic acid |
| Molecular Formula |
C11H18N2O9 |
| Molecular Weight |
322.2686 |
| InChl |
InChI=1/C11H18N2O9/c14-7(1-12(3-8(15)16)4-9(17)18)2-13(5-10(19)20)6-11(21)22/h7,14H,1-6H2,(H,15,16)(H,17,18)(H,19,20)(H,21,22) |
| CAS Registry Number |
3148-72-9 |
| EINECS |
221-575-6 |
| Molecular Structure |
 |
| Density |
1.603g/cm3 |
| Melting Point |
194-195℃ |
| Boiling Point |
664.4°C at 760 mmHg |
| Refractive Index |
1.593 |
| Flash Point |
355.6°C |
| Vapour Pressur |
1.74E-20mmHg at 25°C |
| Hazard Symbols |
 Xi##Irritant:;
|
| Risk Codes |
R36##Irritating to eyes.:;
|
| Safety Description |
S24/25##Avoid contact with skin and eyes.:;
|
