33059-05-1 2-hydroxy-4-(isooctoxy)benzophenone |
|
| Product Name | 2-hydroxy-4-(isooctoxy)benzophenone |
| Synonyms | Methanone, (2-hydroxy-4-(isooctyloxy)phenyl)phenyl-;2-Hydroxy-4-isooctoxybenzophenone;2-Hydroxy-4-(isooctoxy)benzophenone;{2-hydroxy-4-[(6-methylheptyl)oxy]phenyl}(phenyl)methanone |
| Molecular Formula | C21H26O3 |
| Molecular Weight | 326.4293 |
| InChl | InChI=1/C21H26O3/c1-16(2)9-5-4-8-14-24-18-12-13-19(20(22)15-18)21(23)17-10-6-3-7-11-17/h3,6-7,10-13,15-16,22H,4-5,8-9,14H2,1-2H3 |
| CAS Registry Number | 33059-05-1 |
| EINECS | 251-363-9 |
| Molecular Structure |  |
| Density | 1.067g/cm3 |
| Boiling Point | 453.1°C at 760 mmHg |
| Refractive Index | 1.546 |
| Flash Point | 153°C |
| Vapour Pressur | 7.94E-09mmHg at 25°C |
- If you plan to source chemicals from China, just go to ChemNet mall, we will get the latest and competitive price from China manufacturers for you. Please visit
ChemNet Mall
