ChemIndex - A free chemical CAS databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
34164-32-4 3-chloro-N-[2-(4-ethoxy-3-methoxyphenyl)ethyl]propanamide |
|
| Chemical Name | 3-chloro-N-[2-(4-ethoxy-3-methoxyphenyl)ethyl]propanamide |
| Molecular Formula | C14H20ClNO3 |
| Molecular Weight | 285.7665 |
| InChl | InChI=1/C14H20ClNO3/c1-3-19-12-5-4-11(10-13(12)18-2)7-9-16-14(17)6-8-15/h4-5,10H,3,6-9H2,1-2H3,(H,16,17) |
| CAS Registry Number | 34164-32-4 |
| Molecular Structure | ![]() |
| Density | 1.126g/cm3 |
| Boiling Point | 465.3°C at 760 mmHg |
| Refractive Index | 1.512 |
| Flash Point | 235.2°C |
| Vapour Pressur | 7.8E-09mmHg at 25°C |
| MSDS | |