ChemIndex - A free chemical CAS databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
3435-29-8 4-Pyrimidinamine, 6-phenyl- |
|
| Chemical Name | 4-Pyrimidinamine, 6-phenyl- |
| Synonyms | 4-Amino-6-phenylpyrimidine; 6-Phenyl-4-pyrimidinamine ;6-phenylpyrimidin-4-amine |
| Molecular Formula | C10H9N3 |
| Molecular Weight | 171.1986 |
| InChl | InChI=1/C10H9N3/c11-10-6-9(12-7-13-10)8-4-2-1-3-5-8/h1-7H,(H2,11,12,13) |
| CAS Registry Number | 3435-29-8 |
| Molecular Structure | ![]() |
| Density | 1.193g/cm3 |
| Boiling Point | 388.2°C at 760 mmHg |
| Refractive Index | 1.633 |
| Flash Point | 216.9°C |
| Vapour Pressur | 3.12E-06mmHg at 25°C |
| MSDS | |