3556-83-0 Methyl 3-methoxy-4-methylbenzoate |
| Product Name |
Methyl 3-methoxy-4-methylbenzoate |
| Synonyms |
3-Methoxy-4-methylbenzoic acid methyl ester;3-Methoxy-p-toluic acid methyl ester (COOCH3=1);methyl 4-methoxy-3-methylbenzoate |
| Molecular Formula |
C10H12O3 |
| Molecular Weight |
180.2005 |
| InChl |
InChI=1/C10H12O3/c1-7-6-8(10(11)13-3)4-5-9(7)12-2/h4-6H,1-3H3 |
| CAS Registry Number |
3556-83-0 |
| Molecular Structure |
 |
| Density |
1.075g/cm3 |
| Melting Point |
50-120℃ |
| Boiling Point |
269.5°C at 760 mmHg |
| Refractive Index |
1.502 |
| Flash Point |
107.5°C |
| Vapour Pressur |
0.00723mmHg at 25°C |
| Safety Description |
S24/25##Avoid contact with skin and eyes.:;
|
