ChemIndex - A free chemical CAS databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
36953-87-4 2-hydroxy-3-pentanoyl-4H-chromen-4-one |
|
| Chemical Name | 2-hydroxy-3-pentanoyl-4H-chromen-4-one |
| Molecular Formula | C14H14O4 |
| Molecular Weight | 246.2586 |
| InChl | InChI=1/C14H14O4/c1-2-3-7-10(15)12-13(16)9-6-4-5-8-11(9)18-14(12)17/h4-6,8,17H,2-3,7H2,1H3 |
| CAS Registry Number | 36953-87-4 |
| Molecular Structure | ![]() |
| Density | 1.29g/cm3 |
| Boiling Point | 378.2°C at 760 mmHg |
| Refractive Index | 1.59 |
| Flash Point | 141.3°C |
| Vapour Pressur | 2.16E-06mmHg at 25°C |
| MSDS | |