3729-21-3 4-isocyanatobenzoyl chloride |
|
| Product Name | 4-isocyanatobenzoyl chloride |
| Synonyms | 4-Isocyanatobenzoyl chloride;Benzoyl chloride, 4-isocyanato- |
| Molecular Formula | C8H4ClNO2 |
| Molecular Weight | 181.5759 |
| InChl | InChI=1/C8H4ClNO2/c9-8(12)6-1-3-7(4-2-6)10-5-11/h1-4H |
| CAS Registry Number | 3729-21-3 |
| Molecular Structure |  |
| Density | 1.28g/cm3 |
| Boiling Point | 271.5°C at 760 mmHg |
| Refractive Index | 1.567 |
| Flash Point | 105.2°C |
| Vapour Pressur | 0.00642mmHg at 25°C |
- If you plan to source chemicals from China, just go to ChemNet mall, we will get the latest and competitive price from China manufacturers for you. Please visit
ChemNet Mall
