3882-06-2 dicyclohexylammonium nitrate |
|
| Product Name | dicyclohexylammonium nitrate |
| Synonyms | Cyclohexanamine, N-cyclohexyl-, nitrate (9CI);Dicyclohexylamine nitrate;Dicyclohexylammonium nitrate;N-Cyclohexylcyclohexanamine nitrate;Cyclohexanamine, N-cyclohexyl-, nitrate;Dicyclohexylamine, nitrate;N-cyclohexylcyclohexanaminium nitrate |
| Molecular Formula | C12H24N2O3 |
| Molecular Weight | 244.3306 |
| InChl | InChI=1/C12H23N.NO3/c1-3-7-11(8-4-1)13-12-9-5-2-6-10-12;2-1(3)4/h11-13H,1-10H2;/q;-1/p+1 |
| CAS Registry Number | 3882-06-2 |
| EINECS | 223-411-9 |
| Molecular Structure |  |
| Boiling Point | 256.1°C at 760 mmHg |
| Flash Point | 96.1°C |
| Vapour Pressur | 0.0157mmHg at 25°C |
| MSDS | |
- If you plan to source chemicals from China, just go to ChemNet mall, we will get the latest and competitive price from China manufacturers for you. Please visit
ChemNet Mall
- Acme Sujan Chemicals
TEL:91 257 2236844
FAX:
