ChemIndex - A free chemical CAS databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
39484-09-8 N-acetyl-S-(2,5-dihydroxyphenyl)-L-cysteine |
|
| Chemical Name | N-acetyl-S-(2,5-dihydroxyphenyl)-L-cysteine |
| Synonyms | L-Cysteine, N-acetyl-S-(2,5-dihydroxyphenyl)- |
| Molecular Formula | C11H13NO5S |
| Molecular Weight | 271.2896 |
| InChl | InChI=1/C11H13NO5S/c1-6(13)12-8(11(16)17)5-18-10-4-7(14)2-3-9(10)15/h2-4,8,14-15H,5H2,1H3,(H,12,13)(H,16,17)/t8-/m0/s1 |
| CAS Registry Number | 39484-09-8 |
| Molecular Structure | ![]() |
| Density | 1.5g/cm3 |
| Boiling Point | 601.6°C at 760 mmHg |
| Refractive Index | 1.657 |
| Flash Point | 317.6°C |
| Vapour Pressur | 2.53E-15mmHg at 25°C |
| MSDS | |