402-63-1 1-(3-fluorophenyl)ethanol |
| Product Name |
1-(3-fluorophenyl)ethanol |
| Synonyms |
3-fluorophenyl methyl carbinol;3-Fluoro-alpha-methylbenzyl alcohol~3-Fluorophenyl methyl carbinol;3-Fluoro-α-methylbenzenemethanol |
| Molecular Formula |
C8H9FO |
| Molecular Weight |
140.1549 |
| InChl |
InChI=1/C8H9FO/c1-6(10)7-3-2-4-8(9)5-7/h2-6,10H,1H3 |
| CAS Registry Number |
402-63-1 |
| EINECS |
206-950-4 |
| Molecular Structure |
 |
| Density |
1.123g/cm3 |
| Boiling Point |
196.2°C at 760 mmHg |
| Refractive Index |
1.51 |
| Flash Point |
90.1°C |
| Vapour Pressur |
0.251mmHg at 25°C |
| Safety Description |
S24/25##Avoid contact with skin and eyes.:;
|
