ChemIndex - A free chemical CAS databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
40321-76-4 1,2,3,7,8-pentachlorooxanthrene |
|
| Chemical Name | 1,2,3,7,8-pentachlorooxanthrene |
| Synonyms | 1,2,3,7,8-Pentachlorooxanthrene;dibenzo[b,e][1,4]dioxin, 1,2,3,7,8-pentachloro- |
| Molecular Formula | C12H3Cl5O2 |
| Molecular Weight | 356.416 |
| InChl | InChI=1/C12H3Cl5O2/c13-4-1-7-8(2-5(4)14)19-12-9(18-7)3-6(15)10(16)11(12)17/h1-3H |
| CAS Registry Number | 40321-76-4 |
| Molecular Structure | ![]() |
| Density | 1.714g/cm3 |
| Boiling Point | 448.5°C at 760 mmHg |
| Refractive Index | 1.661 |
| Flash Point | 174°C |
| Vapour Pressur | 8.14E-08mmHg at 25°C |
| MSDS | |