40397-98-6 2,5-dimethylphenyl isocyanate |
|
| Product Name | 2,5-dimethylphenyl isocyanate |
| Synonyms | 2,5-Isocyanatoxylene;2-isocyanato-1,4-dimethylbenzene |
| Molecular Formula | C9H9NO |
| Molecular Weight | 147.1739 |
| InChl | InChI=1/C9H9NO/c1-7-3-4-8(2)9(5-7)10-6-11/h3-5H,1-2H3 |
| CAS Registry Number | 40397-98-6 |
| Molecular Structure |  |
| Density | 0.98g/cm3 |
| Boiling Point | 224.4°C at 760 mmHg |
| Refractive Index | 1.515 |
| Flash Point | 78.8°C |
| Vapour Pressur | 0.0914mmHg at 25°C |
| Hazard Symbols |  Xn##Harmful:; |
| Risk Codes | R23/25##Toxic by inhalation and if swallowed.||R36/37/38##Irritating to eyes, respiratory system and skin.||R42##May cause sensitization by inhalation.:; |
| Safety Description | S23##Do not inhale gas/fumes/vapour/spray.||S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; |
- Capot Chemical Co., Ltd.
TEL:0086-571-85586718
FAX:0086-571-85864795
