ChemIndex - A free chemical CAS databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
405238-93-9 4-amino-1-[(2R,5S)-3-fluoro-5-(hydroxymethyl)-2,5-dihydrofuran-2-yl]-5-methylpyrimidin-2(1H)-one |
|
| Chemical Name | 4-amino-1-[(2R,5S)-3-fluoro-5-(hydroxymethyl)-2,5-dihydrofuran-2-yl]-5-methylpyrimidin-2(1H)-one |
| Molecular Formula | C10H12FN3O3 |
| Molecular Weight | 241.219 |
| InChl | InChI=1/C10H12FN3O3/c1-5-3-14(10(16)13-8(5)12)9-7(11)2-6(4-15)17-9/h2-3,6,9,15H,4H2,1H3,(H2,12,13,16)/t6-,9+/m0/s1 |
| CAS Registry Number | 405238-93-9 |
| Molecular Structure | ![]() |
| Density | 1.58g/cm3 |
| Boiling Point | 433.9°C at 760 mmHg |
| Refractive Index | 1.646 |
| Flash Point | 216.2°C |
| Vapour Pressur | 2.38E-09mmHg at 25°C |
| MSDS | |