ChemIndex - A free chemical CAS databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
406681-37-6 N-Boc-(S)-cyclopropylalanine benzyl ester |
|
| Chemical Name | N-Boc-(S)-cyclopropylalanine benzyl ester |
| Synonyms | benzyl (2S)-3-cyclopropyl-2-(methoxycarbonylamino)propanoate; ethane |
| Molecular Formula | C17H25NO4 |
| Molecular Weight | 307.3847 |
| InChl | InChI=1/C15H19NO4.C2H6/c1-19-15(18)16-13(9-11-7-8-11)14(17)20-10-12-5-3-2-4-6-12;1-2/h2-6,11,13H,7-10H2,1H3,(H,16,18);1-2H3/t13-;/m0./s1 |
| CAS Registry Number | 406681-37-6 |
| Molecular Structure | ![]() |
| Boiling Point | 428.9°C at 760 mmHg |
| Flash Point | 213.2°C |
| Vapour Pressur | 1.46E-07mmHg at 25°C |
| MSDS | |