ChemIndex - A free chemical CAS databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
435345-37-2 N-(furan-2-ylmethyl)cyclohexanaminium |
|
| Chemical Name | N-(furan-2-ylmethyl)cyclohexanaminium |
| Molecular Formula | C11H18NO |
| Molecular Weight | 180.2662 |
| InChl | InChI=1/C11H17NO/c1-2-5-10(6-3-1)12-9-11-7-4-8-13-11/h4,7-8,10,12H,1-3,5-6,9H2/p+1 |
| CAS Registry Number | 435345-37-2 |
| Molecular Structure | ![]() |
| Boiling Point | 262°C at 760 mmHg |
| Flash Point | 112.3°C |
| Vapour Pressur | 0.0112mmHg at 25°C |
| MSDS | |