ChemIndex - A free chemical CAS databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
453-11-2 1-Chloro-3-fluoro-2-propanol |
|
| Chemical Name | 1-Chloro-3-fluoro-2-propanol |
| Synonyms | 1-Chloro-3-fluoroisopropanol;1-chloro-3-fluoropropan-2-ol |
| Molecular Formula | C3H6ClFO |
| Molecular Weight | 112.5305 |
| InChl | InChI=1/C3H6ClFO/c4-1-3(6)2-5/h3,6H,1-2H2 |
| CAS Registry Number | 453-11-2 |
| Molecular Structure | ![]() |
| Density | 1.212g/cm3 |
| Boiling Point | 158.1°C at 760 mmHg |
| Refractive Index | 1.399 |
| Flash Point | 49.4°C |
| Vapour Pressur | 0.951mmHg at 25°C |
| Risk Codes | R10##Flammable.||R20/21/22##Harmful by inhalation, in contact with skin and if swallowed.:; |
| Safety Description | S23##Do not inhale gas/fumes/vapour/spray.||S36/37##Wear suitable protective clothing and gloves.:; |
| MSDS | |