459-73-4 ethyl glycinate |
|
| Product Name | ethyl glycinate |
| Synonyms | glycine ester;ethyl aminoacetate;Glycine Ethylester Hydrocloride;N-(1-Ethyl Propyl)-3,4-Dimethylbenzenamine;Glycine Ethyl Ester;2-ethoxy-2-oxoethanaminium chloride |
| Molecular Formula | C4H9NO2 |
| Molecular Weight | 103.1198 |
| InChl | InChI=1/C4H9NO2/c1-2-7-4(6)3-5/h2-3,5H2,1H3 |
| CAS Registry Number | 459-73-4 |
| EINECS | 207-298-3 |
| Molecular Structure |  |
| Density | 1.013g/cm3 |
| Boiling Point | 109.5°C at 760 mmHg |
| Refractive Index | 1.422 |
| Vapour Pressur | 24.7mmHg at 25°C |
- If you plan to source chemicals from China, just go to ChemNet mall, we will get the latest and competitive price from China manufacturers for you. Please visit
ChemNet Mall
