460-07-1 1-acetylaziridine |
|
| Product Name | 1-acetylaziridine |
| Synonyms | N,N-ethylideneacetamide;1-aziridin-1-ylethanone;N-Acetylethyleneimine |
| Molecular Formula | C4H7NO |
| Molecular Weight | 85.1045 |
| InChl | InChI=1/C4H7NO/c1-4(6)5-2-3-5/h2-3H2,1H3 |
| CAS Registry Number | 460-07-1 |
| EINECS | 207-301-8 |
| Molecular Structure |  |
| Density | 1.126g/cm3 |
| Boiling Point | 174.2°C at 760 mmHg |
| Refractive Index | 1.494 |
| Flash Point | 76.2°C |
| Vapour Pressur | 1.22mmHg at 25°C |
- If you plan to source chemicals from China, just go to ChemNet mall, we will get the latest and competitive price from China manufacturers for you. Please visit
ChemNet Mall
