ChemIndex - A free chemical CAS databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
4823-31-8 3-(4-bromophenyl)-5-(2,3-dihydro-1,4-benzodioxin-6-yl)-1-phenyl-3a,6a-dihydropyrrolo[3,4-c]pyrazole-4,6(1H,5H)-dione |
|
| Chemical Name | 3-(4-bromophenyl)-5-(2,3-dihydro-1,4-benzodioxin-6-yl)-1-phenyl-3a,6a-dihydropyrrolo[3,4-c]pyrazole-4,6(1H,5H)-dione |
| Molecular Formula | C25H18BrN3O4 |
| Molecular Weight | 504.3321 |
| InChl | InChI=1/C25H18BrN3O4/c26-16-8-6-15(7-9-16)22-21-23(29(27-22)17-4-2-1-3-5-17)25(31)28(24(21)30)18-10-11-19-20(14-18)33-13-12-32-19/h1-11,14,21,23H,12-13H2 |
| CAS Registry Number | 4823-31-8 |
| Molecular Structure | ![]() |
| Density | 1.62g/cm3 |
| Boiling Point | 728.3°C at 760 mmHg |
| Refractive Index | 1.743 |
| Flash Point | 394.3°C |
| Vapour Pressur | 4.57E-21mmHg at 25°C |
| MSDS | |