ChemIndex - A free chemical CAS databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
49719-60-0 tris(2-hydroxyethyl)ammonium palmitate |
|
| Chemical Name | tris(2-hydroxyethyl)ammonium palmitate |
| Synonyms | Hexadecanoic acid, compd. with 2,2',2''-nitrilotris(ethanol) (1:1);TEA-Palmitate;Triethanolamine palmitate;Palmitic acid, triethanolamine salt;Hexadecanoic acid, compd. with 2,2',2''-nitrotris(ethanol) (1:1);Tris(2-hydroxyethyl)ammonium palmitate;hexadecanoic acid - 2,2',2''-nitrilotriethanol (1:1) |
| Molecular Formula | C22H47NO5 |
| Molecular Weight | 405.6123 |
| InChl | InChI=1/C16H32O2.C6H15NO3/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16(17)18;8-4-1-7(2-5-9)3-6-10/h2-15H2,1H3,(H,17,18);8-10H,1-6H2 |
| CAS Registry Number | 49719-60-0 |
| EINECS | 256-444-2 |
| Molecular Structure | ![]() |
| Boiling Point | 340.6°C at 760 mmHg |
| Flash Point | 154.1°C |
| Vapour Pressur | 3.28E-05mmHg at 25°C |
| MSDS | |