ChemIndex - A free chemical CAS databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
504-57-4 10-Nonadecanone |
|
| Chemical Name | 10-Nonadecanone |
| Synonyms | Di-n-nonyl ketone;nonadecan-10-one |
| Molecular Formula | C19H38O |
| Molecular Weight | 282.5044 |
| InChl | InChI=1/C19H38O/c1-3-5-7-9-11-13-15-17-19(20)18-16-14-12-10-8-6-4-2/h3-18H2,1-2H3 |
| CAS Registry Number | 504-57-4 |
| EINECS | 207-994-7 |
| Molecular Structure | ![]() |
| Density | 0.832g/cm3 |
| Melting Point | 55-57℃ |
| Boiling Point | 351.2°C at 760 mmHg |
| Refractive Index | 1.443 |
| Flash Point | 81.6°C |
| Vapour Pressur | 4.17E-05mmHg at 25°C |
| Safety Description | S24/25##Avoid contact with skin and eyes.:; |
| MSDS | |