5081-37-8 Methyl 3-methoxy-4-nitrobenzoate |
| Product Name |
Methyl 3-methoxy-4-nitrobenzoate |
| Synonyms |
3-Methoxy-4-nitrobenzoic acid methyl ester;acid methyl ester |
| Molecular Formula |
C9H9NO5 |
| Molecular Weight |
211.1715 |
| InChl |
InChI=1/C9H9NO5/c1-14-8-5-6(9(11)15-2)3-4-7(8)10(12)13/h3-5H,1-2H3 |
| CAS Registry Number |
5081-37-8 |
| Molecular Structure |
 |
| Density |
1.294g/cm3 |
| Melting Point |
86-88℃ |
| Boiling Point |
350.7°C at 760 mmHg |
| Refractive Index |
1.54 |
| Flash Point |
168.3°C |
| Vapour Pressur |
4.3E-05mmHg at 25°C |
| Safety Description |
S22##Do not inhale dust.||S24/25##Avoid contact with skin and eyes.:;
|
