50992-43-3 4-chloro-2-isopropyl-m-cresol |
|
| Product Name | 4-chloro-2-isopropyl-m-cresol |
| Synonyms | 4-Chloro-2-isopropyl-m-cresol;4-chloro-3-methyl-2-(1-methylethyl)phenol |
| Molecular Formula | C10H13ClO |
| Molecular Weight | 184.6626 |
| InChl | InChI=1/C10H13ClO/c1-6(2)10-7(3)8(11)4-5-9(10)12/h4-6,12H,1-3H3 |
| CAS Registry Number | 50992-43-3 |
| EINECS | 256-898-1 |
| Molecular Structure |  |
| Density | 1.111g/cm3 |
| Boiling Point | 258.1°C at 760 mmHg |
| Refractive Index | 1.538 |
| Flash Point | 109.9°C |
| Vapour Pressur | 0.00869mmHg at 25°C |
- If you plan to source chemicals from China, just go to ChemNet mall, we will get the latest and competitive price from China manufacturers for you. Please visit
ChemNet Mall
