51-81-0 3-hydroxyanilinium chloride |
|
| Product Name | 3-hydroxyanilinium chloride |
| Synonyms | 3-Aminophenol hydrochloride |
| Molecular Formula | C6H8ClNO |
| Molecular Weight | 145.5868 |
| InChl | InChI=1/C6H7NO.ClH/c7-5-2-1-3-6(8)4-5;/h1-4,8H,7H2;1H |
| CAS Registry Number | 51-81-0 |
| EINECS | 200-125-2 |
| Molecular Structure |  |
| Boiling Point | 298.6°C at 760 mmHg |
| Flash Point | 116.4°C |
| Vapour Pressur | 0.000709mmHg at 25°C |
- If you plan to source chemicals from China, just go to ChemNet mall, we will get the latest and competitive price from China manufacturers for you. Please visit
ChemNet Mall
