51163-28-1 4-Chloro-2-fluorophenyl isocyanate |
|
| Product Name | 4-Chloro-2-fluorophenyl isocyanate |
| Synonyms | 4-chloro-2-fluoro-1-isocyanatobenzene |
| Molecular Formula | C7H3ClFNO |
| Molecular Weight | 171.5562 |
| InChl | InChI=1/C7H3ClFNO/c8-5-1-2-7(10-4-11)6(9)3-5/h1-3H |
| CAS Registry Number | 51163-28-1 |
| Molecular Structure |  |
| Density | 1.31g/cm3 |
| Boiling Point | 208.3°C at 760 mmHg |
| Refractive Index | 1.533 |
| Flash Point | 79.8°C |
| Vapour Pressur | 0.215mmHg at 25°C |
- If you plan to source chemicals from China, just go to ChemNet mall, we will get the latest and competitive price from China manufacturers for you. Please visit
ChemNet Mall
