51421-99-9 4-chloro-2-methoxypyrimidine |
|
| Product Name | 4-chloro-2-methoxypyrimidine |
| Synonyms | pyrimidine, 4-chloro-2-methoxy- |
| Molecular Formula | C5H5ClN2O |
| Molecular Weight | 144.559 |
| InChl | InChI=1/C5H5ClN2O/c1-9-5-7-3-2-4(6)8-5/h2-3H,1H3 |
| CAS Registry Number | 51421-99-9 |
| Molecular Structure |  |
| Density | 1.293g/cm3 |
| Boiling Point | 234.507°C at 760 mmHg |
| Refractive Index | 1.52 |
| Flash Point | 95.627°C |
| Vapour Pressur | 0.08mmHg at 25°C |
- If you plan to source chemicals from China, just go to ChemNet mall, we will get the latest and competitive price from China manufacturers for you. Please visit
ChemNet Mall
