54714-10-2 2,5-Diphenyl-4-hydroxy-3-oxo-2,3-dihydrothiophene 1,1-dioxide |
| Product Name |
2,5-Diphenyl-4-hydroxy-3-oxo-2,3-dihydrothiophene 1,1-dioxide |
| Synonyms |
2,5-diphenyl-4-hydroxy-3-thiophenone 1,1-dioxide;4-hydroxy-2,5-diphenyl-3(2H)-thiophenone-1,1-diox;HOTDO~4-Hydroxy-2,5-diphenyl-3(2H)thiophenone-1,1-dioxide;4-Hydroxy-2,5-diphenyl-3-thiophenone 1,1-dioxide;4-hydroxy-2,5-diphenylthiophen-3(2H)-one 1,1-dioxide;4-hydroxy-2,5-diphenylthiophen-3(2H)-one |
| Molecular Formula |
C16H12O2S |
| Molecular Weight |
268.3303 |
| InChl |
InChI=1/C16H12O2S/c17-13-14(18)16(12-9-5-2-6-10-12)19-15(13)11-7-3-1-4-8-11/h1-10,15,18H |
| CAS Registry Number |
54714-10-2 |
| Molecular Structure |
 |
| Density |
1.346g/cm3 |
| Melting Point |
238-241℃ |
| Boiling Point |
441.06°C at 760 mmHg |
| Refractive Index |
1.697 |
| Flash Point |
220.546°C |
| Vapour Pressur |
0mmHg at 25°C |
| Risk Codes |
R36/37/38##Irritating to eyes, respiratory system and skin.:;
|
| Safety Description |
S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36##Wear suitable protective clothing.:;
|
