ChemIndex - A free chemical CAS databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
57048-45-0 5-amino-3-pentofuranosyl-3,4-dihydro-7H-imidazo[4,5-b]pyridin-7-one |
|
| Chemical Name | 5-amino-3-pentofuranosyl-3,4-dihydro-7H-imidazo[4,5-b]pyridin-7-one |
| Molecular Formula | C11H14N4O5 |
| Molecular Weight | 282.2527 |
| InChl | InChI=1/C11H14N4O5/c12-6-1-4(17)7-10(14-6)15(3-13-7)11-9(19)8(18)5(2-16)20-11/h1,3,5,8-9,11,16,18-19H,2H2,(H3,12,14,17) |
| CAS Registry Number | 57048-45-0 |
| Molecular Structure | ![]() |
| Density | 2.06g/cm3 |
| Boiling Point | 690.9°C at 760 mmHg |
| Refractive Index | 1.874 |
| Flash Point | 371.6°C |
| Vapour Pressur | 4.88E-20mmHg at 25°C |
| MSDS | |