ChemIndex - A free chemical CAS databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
5799-78-0 4-({2-[(5-methyl-3-phenyl-1,2-oxazol-4-yl)carbonyl]hydrazinylidene}methyl)phenyl 1,3-benzodioxole-5-carboxylate |
|
| Chemical Name | 4-({2-[(5-methyl-3-phenyl-1,2-oxazol-4-yl)carbonyl]hydrazinylidene}methyl)phenyl 1,3-benzodioxole-5-carboxylate |
| Molecular Formula | C26H19N3O6 |
| Molecular Weight | 469.4456 |
| InChl | InChI=1/C26H19N3O6/c1-16-23(24(29-35-16)18-5-3-2-4-6-18)25(30)28-27-14-17-7-10-20(11-8-17)34-26(31)19-9-12-21-22(13-19)33-15-32-21/h2-14H,15H2,1H3,(H,28,30) |
| CAS Registry Number | 5799-78-0 |
| Molecular Structure | ![]() |
| Density | 1.37g/cm3 |
| Refractive Index | 1.657 |
| MSDS | |