ChemIndex - A free chemical CAS databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
5857-14-7 2-[(4-chlorobenzyl)sulfanyl]-5,6,7,8-tetrahydroquinoline-3-carbonitrile |
|
| Chemical Name | 2-[(4-chlorobenzyl)sulfanyl]-5,6,7,8-tetrahydroquinoline-3-carbonitrile |
| Synonyms | 2-(4-Chloro-benzylsulfanyl)-5,6,7,8-tetrahydro-quinoline-3-carbonitrile |
| Molecular Formula | C17H15ClN2S |
| Molecular Weight | 314.8324 |
| InChl | InChI=1/C17H15ClN2S/c18-15-7-5-12(6-8-15)11-21-17-14(10-19)9-13-3-1-2-4-16(13)20-17/h5-9H,1-4,11H2 |
| CAS Registry Number | 5857-14-7 |
| Molecular Structure | ![]() |
| Density | 1.31g/cm3 |
| Boiling Point | 465.5°C at 760 mmHg |
| Refractive Index | 1.652 |
| Flash Point | 235.3°C |
| Vapour Pressur | 7.63E-09mmHg at 25°C |
| MSDS | |