ChemIndex - A free chemical CAS databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
59824-10-1 N,N''-(2E)-but-2-ene-1,4-diylbis[1-methyl-3-phenyl(thiourea)] |
|
| Chemical Name | N,N''-(2E)-but-2-ene-1,4-diylbis[1-methyl-3-phenyl(thiourea)] |
| Molecular Formula | C20H24N4S2 |
| Molecular Weight | 384.5614 |
| InChl | InChI=1/C20H24N4S2/c1-23(19(25)21-17-11-5-3-6-12-17)15-9-10-16-24(2)20(26)22-18-13-7-4-8-14-18/h3-14H,15-16H2,1-2H3,(H,21,25)(H,22,26)/b10-9+ |
| CAS Registry Number | 59824-10-1 |
| Molecular Structure | ![]() |
| Density | 1.255g/cm3 |
| Boiling Point | 515.6°C at 760 mmHg |
| Refractive Index | 1.708 |
| Flash Point | 265.6°C |
| Vapour Pressur | 9.72E-11mmHg at 25°C |
| MSDS | |