ChemIndex - A free chemical CAS databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
610-69-5 2-nitrophenyl acetate |
|
| Chemical Name | 2-nitrophenyl acetate |
| Synonyms | 2-Nitrophenyl acetate;Acetic acid 2-nitrophenyl ester |
| Molecular Formula | C8H7NO4 |
| Molecular Weight | 181.1455 |
| InChl | InChI=1/C8H7NO4/c1-6(10)13-8-5-3-2-4-7(8)9(11)12/h2-5H,1H3 |
| CAS Registry Number | 610-69-5 |
| EINECS | 210-233-1 |
| Molecular Structure | ![]() |
| Density | 1.304g/cm3 |
| Melting Point | 39-41℃ |
| Boiling Point | 274.8°C at 760 mmHg |
| Refractive Index | 1.548 |
| Flash Point | 139.8°C |
| Vapour Pressur | 0.00528mmHg at 25°C |
| Safety Description | S22##Do not inhale dust.||S24/25##Avoid contact with skin and eyes.:; |
| MSDS | |