617-54-9 Citraconicaciddimethylester; 99% |
|
| Product Name | Citraconicaciddimethylester; 99% |
| Synonyms | Citraconic acid dimethyl ester;dimethyl (2E)-2-methylbut-2-enedioate;dimethyl (2Z)-2-methylbut-2-enedioate |
| Molecular Formula | C7H10O4 |
| Molecular Weight | 158.1519 |
| InChl | InChI=1/C7H10O4/c1-5(7(9)11-3)4-6(8)10-2/h4H,1-3H3/b5-4- |
| CAS Registry Number | 617-54-9 |
| Molecular Structure |  |
| Density | 1.094g/cm3 |
| Boiling Point | 210.5°C at 760 mmHg |
| Refractive Index | 1.438 |
| Flash Point | 91.5°C |
| Vapour Pressur | 0.192mmHg at 25°C |
- If you plan to source chemicals from China, just go to ChemNet mall, we will get the latest and competitive price from China manufacturers for you. Please visit
ChemNet Mall
