617-74-3 2-ethoxyethyl lactate |
|
| Product Name | 2-ethoxyethyl lactate |
| Synonyms | 2-Ethoxyethyl lactate;2-ethoxyethyl 2-hydroxypropanoate |
| Molecular Formula | C7H14O4 |
| Molecular Weight | 162.1837 |
| InChl | InChI=1/C7H14O4/c1-3-10-4-5-11-7(9)6(2)8/h6,8H,3-5H2,1-2H3 |
| CAS Registry Number | 617-74-3 |
| EINECS | 210-525-9 |
| Molecular Structure |  |
| Density | 1.068g/cm3 |
| Boiling Point | 241°C at 760 mmHg |
| Refractive Index | 1.433 |
| Flash Point | 91.5°C |
| Vapour Pressur | 0.00635mmHg at 25°C |
- If you plan to source chemicals from China, just go to ChemNet mall, we will get the latest and competitive price from China manufacturers for you. Please visit
ChemNet Mall
