ChemIndex - A free chemical CAS databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
618-71-3 Ethyl 3,5-dinitrobenzoate |
|
| Chemical Name | Ethyl 3,5-dinitrobenzoate |
| Synonyms | 3,5-Dinitrobenzoic acid ethyl ester |
| Molecular Formula | C9H8N2O6 |
| Molecular Weight | 240.1696 |
| InChl | InChI=1/C9H8N2O6/c1-2-17-9(12)6-3-7(10(13)14)5-8(4-6)11(15)16/h3-5H,2H2,1H3 |
| CAS Registry Number | 618-71-3 |
| EINECS | 210-559-4 |
| Molecular Structure | ![]() |
| Density | 1.433g/cm3 |
| Melting Point | 94-95℃ |
| Boiling Point | 367.1°C at 760 mmHg |
| Refractive Index | 1.58 |
| Flash Point | 171.8°C |
| Vapour Pressur | 1.39E-05mmHg at 25°C |
| Safety Description | S22##Do not inhale dust.||S24/25##Avoid contact with skin and eyes.:; |
| MSDS | |